CAS 94-00-8 appears in our catalog under these names: phenyl pyridine-4-carboxylate, 95%, Phenyl Isonicotinate, Phenyl Isonicotinate, >98.0%(GC)(T), Phenyl isonicotinate, 97%. Offered by: Combi-blocks, GLPBio, TCI, Fluorochem. Available pack sizes: 1g, 5g, 25g, 10g, 100g.
Phenyl pyridine-4-carboxylate (CAS 94-00-8) is a chemical compound with the molecular formula C12H9NO2 and a molecular weight of 199.20 g/mol. IUPAC name: phenyl pyridine-4-carboxylate. InChIKey: RGQQGHGIUCRECH-UHFFFAOYSA-N.
| Molecular formula | C12H9NO2 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | phenyl pyridine-4-carboxylate |
| InChIKey | RGQQGHGIUCRECH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC(=O)C2=CC=NC=C2 |
Computed by PubChem (NCBI)