CAS 754190-58-4 appears in our catalog under these names: 3-Quinolin-8-ylacrylic acid, 95%, (2E)-3-(Quinolin-8-yl)prop-2-enoic acid, (2E)-3-(8-Quinolinyl)-2-propenoic acid, 98%, 98%, (E)-3-(Quinolin-8-yl)acrylic acid, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g, 50mg.
(E)-3-quinolin-8-ylprop-2-enoic acid (CAS 754190-58-4) is a chemical compound with the molecular formula C12H9NO2 and a molecular weight of 199.20 g/mol. IUPAC name: (E)-3-quinolin-8-ylprop-2-enoic acid. InChIKey: JIEIJAGBFCDWPA-VOTSOKGWSA-N.
| Molecular formula | C12H9NO2 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | (E)-3-quinolin-8-ylprop-2-enoic acid |
| InChIKey | JIEIJAGBFCDWPA-VOTSOKGWSA-N |
| SMILES | C1=CC2=C(C(=C1)/C=C/C(=O)O)N=CC=C2 |
Computed by PubChem (NCBI)