cas: 1035458-54-8 — see every product listed under this CAS number, including other names
4-(4,4,5,5-Tetramethyl-[1,3,2]dioxaborolan-2-yl)quinoline 95% (CAS 1035458-54-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A281536-10g |
| cas | 1035458-54-8 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 3162.75 Pln | |
| Ambeed | 100mg | 164.56 Pln | |
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 498.31 Pln | |
| Ambeed | 5g | 2000.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A281536 |
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline (CAS 1035458-54-8) is a chemical compound with the molecular formula C15H18BNO2 and a molecular weight of 255.12 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline. InChIKey: LJFSIDNUMPTTAF-UHFFFAOYSA-N.
| Molecular formula | C15H18BNO2 |
|---|---|
| Molecular weight | 255.12 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
| InChIKey | LJFSIDNUMPTTAF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=NC3=CC=CC=C23 |
Computed by PubChem (NCBI)