cas: 1083326-41-3 — see every product listed under this CAS number, including other names
4-(4,4,5,5-Tetramethyl-1,3,2-Dioxaborolan-2-yl)-1H-Pyrazole-1-Acetic Acid, 97%, 97% (CAS 1083326-41-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1194OQ-250mg |
| cas | 1083326-41-3 |
| size | 250mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 304.40 Pln | |
| Chemat | 10g | 510.80 Pln | |
| Chemat | 25g | 1096.40 Pln | |
| Chemat | 50g | 1994.00 Pln | |
| Chemat | 100g | 3645.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]acetic acid (CAS 1083326-41-3) is a chemical compound with the molecular formula C11H17BN2O4 and a molecular weight of 252.08 g/mol. IUPAC name: 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]acetic acid. InChIKey: IBRLSABGLKHIKN-UHFFFAOYSA-N.
| Molecular formula | C11H17BN2O4 |
|---|---|
| Molecular weight | 252.08 g/mol |
| IUPAC name | 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]acetic acid |
| InChIKey | IBRLSABGLKHIKN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)CC(=O)O |
Computed by PubChem (NCBI)