CAS 1622992-09-9 is the registry number for Methyl 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-1-methyl-1H-pyrazole-5-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-1-methylpyrazole-5-carboxylate (CAS 1622992-09-9) is a chemical compound with the molecular formula C11H17BN2O4 and a molecular weight of 252.08 g/mol. IUPAC name: methyl 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-1-methylpyrazole-5-carboxylate. InChIKey: HZMASZFQXQCDPW-UHFFFAOYSA-N.
| Molecular formula | C11H17BN2O4 |
|---|---|
| Molecular weight | 252.08 g/mol |
| IUPAC name | methyl 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-1-methylpyrazole-5-carboxylate |
| InChIKey | HZMASZFQXQCDPW-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=C(N(N=C2)C)C(=O)OC |
Computed by PubChem (NCBI)