CAS 1416060-21-3 is the registry number for 4-(4,4,5,5-Tetramethyl-[1,3,2]dioxaborolan-2-yl)-pyrazole-1-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxylate (CAS 1416060-21-3) is a chemical compound with the molecular formula C11H17BN2O4 and a molecular weight of 252.08 g/mol. IUPAC name: methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxylate. InChIKey: FTRGMEDQFMUYHH-UHFFFAOYSA-N.
| Molecular formula | C11H17BN2O4 |
|---|---|
| Molecular weight | 252.08 g/mol |
| IUPAC name | methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxylate |
| InChIKey | FTRGMEDQFMUYHH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)C(=O)OC |
Computed by PubChem (NCBI)