Products 1203672-80-3
CAS 1203672-80-3 is the registry number for 2-(3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 2g, 1g, 5g, 10g.
2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]acetic acid (CAS 1203672-80-3) is a chemical compound with the molecular formula C11H17BN2O4 and a molecular weight of 252.08 g/mol. IUPAC name: 2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]acetic acid. InChIKey: NJPHGLLAXZDZEW-UHFFFAOYSA-N.
| Molecular formula | C11H17BN2O4 |
|---|---|
| Molecular weight | 252.08 g/mol |
| IUPAC name | 2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]acetic acid |
| InChIKey | NJPHGLLAXZDZEW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NN(C=C2)CC(=O)O |
Computed by PubChem (NCBI)