cas: 180516-87-4 — see every product listed under this CAS number, including other names
4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 97% (CAS 180516-87-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 366390010 |
| cas | 180516-87-4 |
| size | 1g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 147.89 Pln | |
| Thermo Scientific (Acros) | 5g | 472.17 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 180516-87-4) is a chemical compound with the molecular formula C13H17BO4 and a molecular weight of 248.08 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: IYDKBQIEOBXLTP-UHFFFAOYSA-N.
| Molecular formula | C13H17BO4 |
|---|---|
| Molecular weight | 248.08 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | IYDKBQIEOBXLTP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)