cas: 180516-87-4 — see every product listed under this CAS number, including other names
4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 98%, 98% (CAS 180516-87-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 5kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11333B-1g |
| cas | 180516-87-4 |
| size | 1g |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 83.60 Pln | |
| Chemat | 25g | 112.40 Pln | |
| Chemat | 50g | 165.20 Pln | |
| Chemat | 100g | 270.80 Pln | |
| Chemat | 250g | 578.00 Pln | |
| Chemat | 5kg | 8956.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 180516-87-4) is a chemical compound with the molecular formula C13H17BO4 and a molecular weight of 248.08 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: IYDKBQIEOBXLTP-UHFFFAOYSA-N.
| Molecular formula | C13H17BO4 |
|---|---|
| Molecular weight | 248.08 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | IYDKBQIEOBXLTP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)