CAS 180516-87-4 appears in our catalog under these names: 4-Carboxyphenylboronic acid pinacol ester, 4-CARBOXYPHENYLBORONIC ACID PINACOL ESTE, 4-Carboxyphenylboronic acid, pinacol ester, 97%, 4-Carboxybenzeneboronic acid pinacol ester, 97% , 4-Carboxyphenylboronic acid pinacol ester 98%. Offered by: Biosynth, Sigma-Aldrich, Combi-blocks, Thermo Scientific (Alfa Aesar), Ambeed. Available pack sizes: 25g, 10g, 50g, 250g, 100g, 5G, 500g, 1000g.
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 180516-87-4) is a chemical compound with the molecular formula C13H17BO4 and a molecular weight of 248.08 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: IYDKBQIEOBXLTP-UHFFFAOYSA-N.
| Molecular formula | C13H17BO4 |
|---|---|
| Molecular weight | 248.08 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | IYDKBQIEOBXLTP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)