cas: 180516-87-4 — see every product listed under this CAS number, including other names
4-Carboxyphenylboronic acid pinacol ester, 98.74% (CAS 180516-87-4) is a chemical reagent available from Chemat. Available pack sizes: 25 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W000887-25 g |
| cas | 180516-87-4 |
| size | 25 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 263.96 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 98.74% |
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 180516-87-4) is a chemical compound with the molecular formula C13H17BO4 and a molecular weight of 248.08 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: IYDKBQIEOBXLTP-UHFFFAOYSA-N.
| Molecular formula | C13H17BO4 |
|---|---|
| Molecular weight | 248.08 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | IYDKBQIEOBXLTP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)