cas: 138500-85-3 — see every product listed under this CAS number, including other names
4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl Bromide, >98.0%(GC)(T) (CAS 138500-85-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T2945-1G |
| cas | 138500-85-3 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 128.18 Pln | |
| TCI | 5g | 374.04 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
2-[4-(bromomethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 138500-85-3) is a chemical compound with the molecular formula C13H18BBrO2 and a molecular weight of 297.00 g/mol. IUPAC name: 2-[4-(bromomethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: CBUOGMOTDGNEAW-UHFFFAOYSA-N.
| Molecular formula | C13H18BBrO2 |
|---|---|
| Molecular weight | 297.00 g/mol |
| IUPAC name | 2-[4-(bromomethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | CBUOGMOTDGNEAW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CBr |
Computed by PubChem (NCBI)