cas: 57478-19-0 — see every product listed under this CAS number, including other names
4-(4-(Trifluoromethyl)phenoxy)aniline 98% (CAS 57478-19-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A246003-25g |
| cas | 57478-19-0 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 5131.88 Pln | |
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 654.06 Pln | |
| Ambeed | 5g | 1722.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A246003 |
4-[4-(trifluoromethyl)phenoxy]aniline (CAS 57478-19-0) is a chemical compound with the molecular formula C13H10F3NO and a molecular weight of 253.22 g/mol. IUPAC name: 4-[4-(trifluoromethyl)phenoxy]aniline. InChIKey: SMLYUHJGJWSUEC-UHFFFAOYSA-N.
| Molecular formula | C13H10F3NO |
|---|---|
| Molecular weight | 253.22 g/mol |
| IUPAC name | 4-[4-(trifluoromethyl)phenoxy]aniline |
| InChIKey | SMLYUHJGJWSUEC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)(F)F)OC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)