4-(4-Bromobenzyl)thiomorpholine 1,1-dioxide, 95%, 95%
cas: 1044924-09-5 — see every product listed under this CAS number, including other names
4-(4-Bromobenzyl)thiomorpholine 1,1-dioxide, 95%, 95% (CAS 1044924-09-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12NVOM-100mg |
| cas | 1044924-09-5 |
| size | 100mg |
| availability | 10g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 477.20 Pln | |
| Chemat | 250mg | 750.80 Pln | |
| Chemat | 1g | 1442.00 Pln | |
| Chemat | 5g | 4197.20 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-[(4-bromophenyl)methyl]-1,4-thiazinane 1,1-dioxide (CAS 1044924-09-5) is a chemical compound with the molecular formula C11H14BrNO2S and a molecular weight of 304.21 g/mol. IUPAC name: 4-[(4-bromophenyl)methyl]-1,4-thiazinane 1,1-dioxide. InChIKey: KSSKLCBHWXGCIQ-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO2S |
|---|---|
| Molecular weight | 304.21 g/mol |
| IUPAC name | 4-[(4-bromophenyl)methyl]-1,4-thiazinane 1,1-dioxide |
| InChIKey | KSSKLCBHWXGCIQ-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCN1CC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)
Synonyms:
4-(4-Bromo-benzyl)-thiomorpholine 1,1-dioxide, 4-(4-bromobenzyl)thiomorpholine 1,1-dioxide, 4-[(4-bromophenyl)methyl]-1,4-thiazinane 1,1-dioxide, KSSKLCBHWXGCIQ-UHFFFAOYSA-N, 4-(4-Bromo-benzyl)-thiomorpholine1,1-dioxide, 4-(4-Bromobenzyl)-thiomorpholine 1,1-dioxide, 4-(4-Bromobenzyl)-thiomorpholine-1,1-dioxide, 4-(4-Bromo-benzyl)-thiomorpholine-1,1-dioxide, 4-[(4-bromophenyl)methyl]-1lambda6-thiomorpholine-1,1-dione