CAS 1803608-16-3 appears in our catalog under these names: 4-(4-Bromophenyl)-4-methylpiperidine hydrochloride, 4-(4-Bromophenyl)-4-methylpiperidine hydrochloride, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg.
4-(4-bromophenyl)-4-methylpiperidine;hydrochloride (CAS 1803608-16-3) is a chemical compound with the molecular formula C12H17BrClN and a molecular weight of 290.63 g/mol. IUPAC name: 4-(4-bromophenyl)-4-methylpiperidine;hydrochloride. InChIKey: KJKBLVJEYNLENN-UHFFFAOYSA-N.
| Molecular formula | C12H17BrClN |
|---|---|
| Molecular weight | 290.63 g/mol |
| IUPAC name | 4-(4-bromophenyl)-4-methylpiperidine;hydrochloride |
| InChIKey | KJKBLVJEYNLENN-UHFFFAOYSA-N |
| SMILES | CC1(CCNCC1)C2=CC=C(C=C2)Br.Cl |
Computed by PubChem (NCBI)