CAS 1394041-42-9 appears in our catalog under these names: 5-Bromo-3,3-diethyl-2,3-dihydro-1H-indole hydrochloride, 95%, 5-Bromo-3,3-diethyl-2,3-dihydro-1H-indole hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5-bromo-3,3-diethyl-1,2-dihydroindole;hydrochloride (CAS 1394041-42-9) is a chemical compound with the molecular formula C12H17BrClN and a molecular weight of 290.63 g/mol. IUPAC name: 5-bromo-3,3-diethyl-1,2-dihydroindole;hydrochloride. InChIKey: SEOHTIZICIPHRU-UHFFFAOYSA-N.
| Molecular formula | C12H17BrClN |
|---|---|
| Molecular weight | 290.63 g/mol |
| IUPAC name | 5-bromo-3,3-diethyl-1,2-dihydroindole;hydrochloride |
| InChIKey | SEOHTIZICIPHRU-UHFFFAOYSA-N |
| SMILES | CCC1(CNC2=C1C=C(C=C2)Br)CC.Cl |
Computed by PubChem (NCBI)