CAS 1803591-42-5 appears in our catalog under these names: 1-[1-(4-bromophenyl)ethyl]pyrrolidine hydrochloride, 95%, 1-(1-(4-Bromophenyl)ethyl)pyrrolidine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 5g, 0,5g.
1-[1-(4-bromophenyl)ethyl]pyrrolidine;hydrochloride (CAS 1803591-42-5) is a chemical compound with the molecular formula C12H17BrClN and a molecular weight of 290.63 g/mol. IUPAC name: 1-[1-(4-bromophenyl)ethyl]pyrrolidine;hydrochloride. InChIKey: RBFHBVGWDQPMSL-UHFFFAOYSA-N.
| Molecular formula | C12H17BrClN |
|---|---|
| Molecular weight | 290.63 g/mol |
| IUPAC name | 1-[1-(4-bromophenyl)ethyl]pyrrolidine;hydrochloride |
| InChIKey | RBFHBVGWDQPMSL-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)Br)N2CCCC2.Cl |
Computed by PubChem (NCBI)