CAS 1050509-24-4 appears in our catalog under these names: N-(4-Chlorobenzyl)cyclopentanamine hydrobromide, 95%, Benzenemethanamine, 4-chloro-N-cyclopentyl-, hydrobromide (1:1), 96%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 5g, 10g, 1g, 250mg, on request.
N-[(4-chlorophenyl)methyl]cyclopentanamine;hydrobromide (CAS 1050509-24-4) is a chemical compound with the molecular formula C12H17BrClN and a molecular weight of 290.63 g/mol. IUPAC name: N-[(4-chlorophenyl)methyl]cyclopentanamine;hydrobromide. InChIKey: RIFNAYXSXOZYFH-UHFFFAOYSA-N.
| Molecular formula | C12H17BrClN |
|---|---|
| Molecular weight | 290.63 g/mol |
| IUPAC name | N-[(4-chlorophenyl)methyl]cyclopentanamine;hydrobromide |
| InChIKey | RIFNAYXSXOZYFH-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NCC2=CC=C(C=C2)Cl.Br |
Computed by PubChem (NCBI)