CAS 84803-46-3 appears in our catalog under these names: Baclofen Impurity 19, 4-(4-Chlorophenyl)-2,6-piperidinedione, >95% (HPLC), 4-(4-Chlorophenyl)piperidine-2,6-dione, 4–(4–Chlorophenyl)piperidine–2,6–dione, 4-(4-Chlorophenyl)piperidine-2,6-dione, 95%, 95%. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Chemat. Available pack sizes: on request, 100mg, 1g, 50mg, 25mg, 250mg, 5g, 10g.
4-(4-chlorophenyl)piperidine-2,6-dione (CAS 84803-46-3) is a chemical compound with the molecular formula C11H10ClNO2 and a molecular weight of 223.65 g/mol. IUPAC name: 4-(4-chlorophenyl)piperidine-2,6-dione. InChIKey: KOZWYRYCGOBBKD-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO2 |
|---|---|
| Molecular weight | 223.65 g/mol |
| IUPAC name | 4-(4-chlorophenyl)piperidine-2,6-dione |
| InChIKey | KOZWYRYCGOBBKD-UHFFFAOYSA-N |
| SMILES | C1C(CC(=O)NC1=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)