cas: 383142-58-3 — see every product listed under this CAS number, including other names
4-(4-Chlorophenyl)thiazole-2-carbaldehyde, 95%, 95% (CAS 383142-58-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BZ1K-100mg |
| cas | 383142-58-3 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 611.60 Pln | |
| Chemat | 250mg | 923.60 Pln | |
| Chemat | 1g | 1782.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(4-chlorophenyl)-1,3-thiazole-2-carbaldehyde (CAS 383142-58-3) is a chemical compound with the molecular formula C10H6ClNOS and a molecular weight of 223.68 g/mol. IUPAC name: 4-(4-chlorophenyl)-1,3-thiazole-2-carbaldehyde. InChIKey: YGKCTNFJQOTDSJ-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNOS |
|---|---|
| Molecular weight | 223.68 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-1,3-thiazole-2-carbaldehyde |
| InChIKey | YGKCTNFJQOTDSJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC(=N2)C=O)Cl |
Computed by PubChem (NCBI)