cas: 60992-98-5 — see every product listed under this CAS number, including other names
4-(4-Fluorophenyl)benzaldehyde (CAS 60992-98-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F014278-250MG |
| cas | 60992-98-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 221.81 Pln | |
| Fluorochem | 5g | 690.40 Pln | |
| Fluorochem | 25g | 2726.14 Pln |
| delivery time | 3-4 weeks |
|---|
4-(4-fluorophenyl)benzaldehyde (CAS 60992-98-5) is a chemical compound with the molecular formula C13H9FO and a molecular weight of 200.21 g/mol. IUPAC name: 4-(4-fluorophenyl)benzaldehyde. InChIKey: ZVMXCNFUJPLQFT-UHFFFAOYSA-N.
| Molecular formula | C13H9FO |
|---|---|
| Molecular weight | 200.21 g/mol |
| IUPAC name | 4-(4-fluorophenyl)benzaldehyde |
| InChIKey | ZVMXCNFUJPLQFT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)