CAS 500-76-5 appears in our catalog under these names: 4-(4-Hydroxyphenoxy)benzoic Acid, >99.0%(GC)(T), 4-(4-Hydroxyphenoxy)benzoic acid, 96%, 96%, 4-(4-Hydroxyphenoxy)benzoic acid, 98%. Offered by: TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
4-(4-hydroxyphenoxy)benzoic acid (CAS 500-76-5) is a chemical compound with the molecular formula C13H10O4 and a molecular weight of 230.22 g/mol. IUPAC name: 4-(4-hydroxyphenoxy)benzoic acid. InChIKey: KLXPCYHWTLAVLN-UHFFFAOYSA-N.
| Molecular formula | C13H10O4 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | 4-(4-hydroxyphenoxy)benzoic acid |
| InChIKey | KLXPCYHWTLAVLN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)OC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)