Products 1778666-12-8

CAS 1778666-12-8 is the registry number for 4-(4-Iodo-1H-pyrazol-1-yl)tetrahydro-2H-thiopyran 1,1-dioxide, 95%. Offered by: Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

4-(4-iodopyrazol-1-yl)thiane 1,1-dioxide (CAS 1778666-12-8) is a chemical compound with the molecular formula C8H11IN2O2S and a molecular weight of 326.16 g/mol. IUPAC name: 4-(4-iodopyrazol-1-yl)thiane 1,1-dioxide. InChIKey: CDKVGFFSRFRHMM-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11IN2O2S
Molecular weight326.16 g/mol
IUPAC name4-(4-iodopyrazol-1-yl)thiane 1,1-dioxide
InChIKeyCDKVGFFSRFRHMM-UHFFFAOYSA-N
SMILESC1CS(=O)(=O)CCC1N2C=C(C=N2)I

Computed by PubChem (NCBI)