CAS 349425-53-2 is the registry number for N'-(4-iodophenyl)-N,N-dimethylsulfamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(dimethylsulfamoylamino)-4-iodobenzene (CAS 349425-53-2) is a chemical compound with the molecular formula C8H11IN2O2S and a molecular weight of 326.16 g/mol. IUPAC name: 1-(dimethylsulfamoylamino)-4-iodobenzene. InChIKey: BREIMGBYDPFYNA-UHFFFAOYSA-N.
| Molecular formula | C8H11IN2O2S |
|---|---|
| Molecular weight | 326.16 g/mol |
| IUPAC name | 1-(dimethylsulfamoylamino)-4-iodobenzene |
| InChIKey | BREIMGBYDPFYNA-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)NC1=CC=C(C=C1)I |
Computed by PubChem (NCBI)