CAS 1529378-53-7 appears in our catalog under these names: 3-(3-Iodo-4-methyl-1H-pyrazol-1-yl)tetrahydrothiophene 1,1-dioxide, 95%, 3-​Iodo-​4-​methyl-​1-​(tetrahydro-​1,​1-​dioxido-​3-​thienyl)​-1H-​pyrazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-(3-iodo-4-methylpyrazol-1-yl)thiolane 1,1-dioxide (CAS 1529378-53-7) is a chemical compound with the molecular formula C8H11IN2O2S and a molecular weight of 326.16 g/mol. IUPAC name: 3-(3-iodo-4-methylpyrazol-1-yl)thiolane 1,1-dioxide. InChIKey: WWQXKACQZHFKMR-UHFFFAOYSA-N.
| Molecular formula | C8H11IN2O2S |
|---|---|
| Molecular weight | 326.16 g/mol |
| IUPAC name | 3-(3-iodo-4-methylpyrazol-1-yl)thiolane 1,1-dioxide |
| InChIKey | WWQXKACQZHFKMR-UHFFFAOYSA-N |
| SMILES | CC1=CN(N=C1I)C2CCS(=O)(=O)C2 |
Computed by PubChem (NCBI)