Products 1326236-62-7
CAS 1326236-62-7 is the registry number for tert-Butyl N-(5-iodo-1,3-thiazol-2-yl)carbamate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl N-(5-iodo-1,3-thiazol-2-yl)carbamate (CAS 1326236-62-7) is a chemical compound with the molecular formula C8H11IN2O2S and a molecular weight of 326.16 g/mol. IUPAC name: tert-butyl N-(5-iodo-1,3-thiazol-2-yl)carbamate. InChIKey: CYJTZVZDJQUKIE-UHFFFAOYSA-N.
| Molecular formula | C8H11IN2O2S |
|---|---|
| Molecular weight | 326.16 g/mol |
| IUPAC name | tert-butyl N-(5-iodo-1,3-thiazol-2-yl)carbamate |
| InChIKey | CYJTZVZDJQUKIE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC=C(S1)I |
Computed by PubChem (NCBI)