cas: 229009-40-9 — see every product listed under this CAS number, including other names
4-(4-Methylpiperazin-1-yl)phenylboronic acid, 97% (CAS 229009-40-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F079794-100MG |
| cas | 229009-40-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 91.65 Pln | |
| Fluorochem | 250mg | 122.89 Pln | |
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 5g | 622.72 Pln | |
| Fluorochem | 10g | 1169.40 Pln | |
| Fluorochem | 25g | 2700.11 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
[4-(4-methylpiperazin-1-yl)phenyl]boronic acid (CAS 229009-40-9) is a chemical compound with the molecular formula C11H17BN2O2 and a molecular weight of 220.08 g/mol. IUPAC name: [4-(4-methylpiperazin-1-yl)phenyl]boronic acid. InChIKey: LSKYURVDOIDSCG-UHFFFAOYSA-N.
| Molecular formula | C11H17BN2O2 |
|---|---|
| Molecular weight | 220.08 g/mol |
| IUPAC name | [4-(4-methylpiperazin-1-yl)phenyl]boronic acid |
| InChIKey | LSKYURVDOIDSCG-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)N2CCN(CC2)C)(O)O |
Computed by PubChem (NCBI)