cas: 10389-51-2 — see every product listed under this CAS number, including other names
4-(4-Nitrophenyl)morpholine, 95% (CAS 10389-51-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F077779-1G |
| cas | 10389-51-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 128.10 Pln | |
| Fluorochem | 100g | 690.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-(4-nitrophenyl)morpholine (CAS 10389-51-2) is a chemical compound with the molecular formula C10H12N2O3 and a molecular weight of 208.21 g/mol. IUPAC name: 4-(4-nitrophenyl)morpholine. InChIKey: IAJDSUYFELYZCS-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O3 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 4-(4-nitrophenyl)morpholine |
| InChIKey | IAJDSUYFELYZCS-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)