cas: 350997-71-6 — see every product listed under this CAS number, including other names
4-(4-Propylphenyl)thiazol-2-amine, 95% (CAS 350997-71-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A889375-100mg |
| cas | 350997-71-6 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 398.19 Pln | |
| Ambeed | 5g | 820.94 Pln | |
| Ambeed | 10g | 1249.25 Pln | |
| Ambeed | 25g | 3007.00 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 242.16 Pln | |
| BLDpharm | 1g | 425.43 Pln | |
| BLDpharm | 5g | 880.83 Pln | |
| BLDpharm | 10g | 1341.77 Pln | |
| BLDpharm | 25g | 3235.55 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-(4-propylphenyl)-1,3-thiazol-2-amine (CAS 350997-71-6) is a chemical compound with the molecular formula C12H14N2S and a molecular weight of 218.32 g/mol. IUPAC name: 4-(4-propylphenyl)-1,3-thiazol-2-amine. InChIKey: MWWKFIPFFAXPGN-UHFFFAOYSA-N.
| Molecular formula | C12H14N2S |
|---|---|
| Molecular weight | 218.32 g/mol |
| IUPAC name | 4-(4-propylphenyl)-1,3-thiazol-2-amine |
| InChIKey | MWWKFIPFFAXPGN-UHFFFAOYSA-N |
| SMILES | CCCC1=CC=C(C=C1)C2=CSC(=N2)N |
Computed by PubChem (NCBI)