cas: 1137671-57-8 — see every product listed under this CAS number, including other names
4-(5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl)benzene-1,2-diamine, 97% (CAS 1137671-57-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A801769-1g |
| cas | 1137671-57-8 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 6163.36 Pln | |
| AmBeed | 250mg | 4301.50 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]benzene-1,2-diamine (CAS 1137671-57-8) is a chemical compound with the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. IUPAC name: 4-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]benzene-1,2-diamine. InChIKey: RENGNJUAFMBRDX-UHFFFAOYSA-N.
| Molecular formula | C15H14N4O2 |
|---|---|
| Molecular weight | 282.30 g/mol |
| IUPAC name | 4-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]benzene-1,2-diamine |
| InChIKey | RENGNJUAFMBRDX-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NN=C(O2)C3=CC(=C(C=C3)N)N |
Computed by PubChem (NCBI)