CAS 1137671-57-8 appears in our catalog under these names: 4-5-(4-Methoxy-phenyl)-[1,3,4]oxadiazol-2-yl-benzene-1,2-diamine, 95%, 4-(5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl)benzene-1,2-diamine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
4-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]benzene-1,2-diamine (CAS 1137671-57-8) is a chemical compound with the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. IUPAC name: 4-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]benzene-1,2-diamine. InChIKey: RENGNJUAFMBRDX-UHFFFAOYSA-N.
| Molecular formula | C15H14N4O2 |
|---|---|
| Molecular weight | 282.30 g/mol |
| IUPAC name | 4-[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]benzene-1,2-diamine |
| InChIKey | RENGNJUAFMBRDX-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NN=C(O2)C3=CC(=C(C=C3)N)N |
Computed by PubChem (NCBI)