Products 1006352-84-6

CAS 1006352-84-6 is the registry number for 3-{(3-(1-Methyl-1H-pyrazol-4-yl)-1H-pyrazol-1-yl)methyl}benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-[[3-(1-methylpyrazol-4-yl)pyrazol-1-yl]methyl]benzoic acid (CAS 1006352-84-6) is a chemical compound with the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. IUPAC name: 3-[[3-(1-methylpyrazol-4-yl)pyrazol-1-yl]methyl]benzoic acid. InChIKey: NXFOKYXDASMLQQ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H14N4O2
Molecular weight282.30 g/mol
IUPAC name3-[[3-(1-methylpyrazol-4-yl)pyrazol-1-yl]methyl]benzoic acid
InChIKeyNXFOKYXDASMLQQ-UHFFFAOYSA-N
SMILESCN1C=C(C=N1)C2=NN(C=C2)CC3=CC(=CC=C3)C(=O)O

Computed by PubChem (NCBI)