CAS 956961-09-4 is the registry number for 3-(1,3-Dimethyl-1H-pyrazol-4-yl)-1-phenyl-1H-pyrazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-(1,3-dimethylpyrazol-4-yl)-1-phenylpyrazole-4-carboxylic acid (CAS 956961-09-4) is a chemical compound with the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. IUPAC name: 3-(1,3-dimethylpyrazol-4-yl)-1-phenylpyrazole-4-carboxylic acid. InChIKey: CVJXYPQXTLEFPE-UHFFFAOYSA-N.
| Molecular formula | C15H14N4O2 |
|---|---|
| Molecular weight | 282.30 g/mol |
| IUPAC name | 3-(1,3-dimethylpyrazol-4-yl)-1-phenylpyrazole-4-carboxylic acid |
| InChIKey | CVJXYPQXTLEFPE-UHFFFAOYSA-N |
| SMILES | CC1=NN(C=C1C2=NN(C=C2C(=O)O)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)