cas: 7016-14-0 — see every product listed under this CAS number, including other names
4-(5-Bromo-2-methoxybenzyl)morpholine (CAS 7016-14-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F632268-1G |
| cas | 7016-14-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3501.91 Pln | |
| Fluorochem | 5g | 10353.66 Pln |
| delivery time | 3-4 weeks |
|---|
4-[(5-bromo-2-methoxyphenyl)methyl]morpholine (CAS 7016-14-0) is a chemical compound with the molecular formula C12H16BrNO2 and a molecular weight of 286.16 g/mol. IUPAC name: 4-[(5-bromo-2-methoxyphenyl)methyl]morpholine. InChIKey: XALVFKRPIMKZDH-UHFFFAOYSA-N.
| Molecular formula | C12H16BrNO2 |
|---|---|
| Molecular weight | 286.16 g/mol |
| IUPAC name | 4-[(5-bromo-2-methoxyphenyl)methyl]morpholine |
| InChIKey | XALVFKRPIMKZDH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Br)CN2CCOCC2 |
Computed by PubChem (NCBI)