4-(Benzo[d]thiazol-2-yl)-N-methylaniline, 97%
cas: 439858-28-3 — see every product listed under this CAS number, including other names
4-(Benzo[d]thiazol-2-yl)-N-methylaniline, 97% (CAS 439858-28-3) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat, BLDpharm.
| brand | Chemat |
|---|---|
| catalog number | Ch11DIIJ-5mg |
| cas | 439858-28-3 |
| size | 5mg |
| availability | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 299.60 Pln | |
| Chemat | 25mg | 419.60 Pln | |
| Chemat | 50mg | 597.20 Pln | |
| Chemat | 100mg | 962.00 Pln | |
| Chemat | 250mg | 1240.40 Pln | |
| Chemat | 1g | 2805.20 Pln | |
| BLDpharm | 5mg | 314.36 Pln | |
| BLDpharm | 25mg | 442.09 Pln | |
| BLDpharm | 50mg | 630.91 Pln | |
| BLDpharm | 100mg | 1014.11 Pln | |
| BLDpharm | 250mg | 1297.35 Pln | |
| BLDpharm | 1g | 2924.55 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-(1,3-benzothiazol-2-yl)-N-methylaniline (CAS 439858-28-3) is a chemical compound with the molecular formula C14H12N2S and a molecular weight of 240.33 g/mol. IUPAC name: 4-(1,3-benzothiazol-2-yl)-N-methylaniline. InChIKey: FHJRKGXJBXPBGA-UHFFFAOYSA-N.
| Molecular formula | C14H12N2S |
|---|---|
| Molecular weight | 240.33 g/mol |
| IUPAC name | 4-(1,3-benzothiazol-2-yl)-N-methylaniline |
| InChIKey | FHJRKGXJBXPBGA-UHFFFAOYSA-N |
| SMILES | CNC1=CC=C(C=C1)C2=NC3=CC=CC=C3S2 |
Computed by PubChem (NCBI)