cas: 678164-30-2 — see every product listed under this CAS number, including other names
4-(Benzyloxy)-1-bromo-2-(trifluoromethyl)benzene (CAS 678164-30-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F689988-5G |
| cas | 678164-30-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1877.48 Pln | |
| Fluorochem | 10g | 3137.45 Pln |
| delivery time | 3-4 weeks |
|---|
1-bromo-4-phenylmethoxy-2-(trifluoromethyl)benzene (CAS 678164-30-2) is a chemical compound with the molecular formula C14H10BrF3O and a molecular weight of 331.13 g/mol. IUPAC name: 1-bromo-4-phenylmethoxy-2-(trifluoromethyl)benzene. InChIKey: OIXYWYPMKGUGIM-UHFFFAOYSA-N.
| Molecular formula | C14H10BrF3O |
|---|---|
| Molecular weight | 331.13 g/mol |
| IUPAC name | 1-bromo-4-phenylmethoxy-2-(trifluoromethyl)benzene |
| InChIKey | OIXYWYPMKGUGIM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C=C2)Br)C(F)(F)F |
Computed by PubChem (NCBI)