4-(Benzyloxy)-1H-indazole, 97%
cas: 850364-08-8 — see every product listed under this CAS number, including other names
4-(Benzyloxy)-1H-indazole, 97% (CAS 850364-08-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A153638-250mg |
| cas | 850364-08-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 520.56 Pln | |
| Ambeed | 5g | 1527.38 Pln | |
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 438.80 Pln | |
| Chemat | 5g | 1341.20 Pln | |
| BLDpharm | 100mg | 214.39 Pln | |
| BLDpharm | 250mg | 297.70 Pln | |
| BLDpharm | 1g | 553.16 Pln | |
| BLDpharm | 5g | 1641.67 Pln | |
| Fluorochem | 100mg | 258.26 Pln | |
| Fluorochem | 250mg | 351.98 Pln | |
| Fluorochem | 1g | 794.53 Pln | |
| Fluorochem | 5g | 2491.85 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
4-phenylmethoxy-1H-indazole (CAS 850364-08-8) is a chemical compound with the molecular formula C14H12N2O and a molecular weight of 224.26 g/mol. IUPAC name: 4-phenylmethoxy-1H-indazole. InChIKey: KTYOLSBHUABXAW-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | 4-phenylmethoxy-1H-indazole |
| InChIKey | KTYOLSBHUABXAW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC3=C2C=NN3 |
Computed by PubChem (NCBI)