cas: 289662-11-9 — see every product listed under this CAS number, including other names
4-(Benzyloxy)-3,5-dichlorobenzaldehyde, 97% (CAS 289662-11-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A310662-10g |
| cas | 289662-11-9 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 20381.20 Pln | |
| AmBeed | 5g | 12002.83 Pln | |
| AmBeed | 25g | 39930.73 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
3,5-dichloro-4-phenylmethoxybenzaldehyde (CAS 289662-11-9) is a chemical compound with the molecular formula C14H10Cl2O2 and a molecular weight of 281.1 g/mol. IUPAC name: 3,5-dichloro-4-phenylmethoxybenzaldehyde. InChIKey: MOEUXDGQMNVPHZ-UHFFFAOYSA-N.
| Molecular formula | C14H10Cl2O2 |
|---|---|
| Molecular weight | 281.1 g/mol |
| IUPAC name | 3,5-dichloro-4-phenylmethoxybenzaldehyde |
| InChIKey | MOEUXDGQMNVPHZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2Cl)C=O)Cl |
Computed by PubChem (NCBI)