CAS 588715-60-0 is the registry number for 3-[(3,4-Dichlorobenzyl)oxy]benzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-[(3,4-dichlorophenyl)methoxy]benzaldehyde (CAS 588715-60-0) is a chemical compound with the molecular formula C14H10Cl2O2 and a molecular weight of 281.1 g/mol. IUPAC name: 3-[(3,4-dichlorophenyl)methoxy]benzaldehyde. InChIKey: SRNAKIRKGJOJIO-UHFFFAOYSA-N.
| Molecular formula | C14H10Cl2O2 |
|---|---|
| Molecular weight | 281.1 g/mol |
| IUPAC name | 3-[(3,4-dichlorophenyl)methoxy]benzaldehyde |
| InChIKey | SRNAKIRKGJOJIO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC2=CC(=C(C=C2)Cl)Cl)C=O |
Computed by PubChem (NCBI)