CAS 1820735-41-8 is the registry number for methyl 3-(3,4-dichlorophenyl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 3-(3,4-dichlorophenyl)benzoate (CAS 1820735-41-8) is a chemical compound with the molecular formula C14H10Cl2O2 and a molecular weight of 281.1 g/mol. IUPAC name: methyl 3-(3,4-dichlorophenyl)benzoate. InChIKey: JYFISDSNEVSCTG-UHFFFAOYSA-N.
| Molecular formula | C14H10Cl2O2 |
|---|---|
| Molecular weight | 281.1 g/mol |
| IUPAC name | methyl 3-(3,4-dichlorophenyl)benzoate |
| InChIKey | JYFISDSNEVSCTG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)