Products 24522-81-4
CAS 24522-81-4 appears in our catalog under these names: 3,3'-Dichloro-4,4'-dihydroxystilbene, 95%, 3,3'-Dichloro-4,4'-dihydroxystilbene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 100g, 25g, 5g, 50g.
2-chloro-4-[(E)-2-(3-chloro-4-hydroxyphenyl)ethenyl]phenol (CAS 24522-81-4) is a chemical compound with the molecular formula C14H10Cl2O2 and a molecular weight of 281.1 g/mol. IUPAC name: 2-chloro-4-[(E)-2-(3-chloro-4-hydroxyphenyl)ethenyl]phenol. InChIKey: FEAJSSRZWFESGG-OWOJBTEDSA-N.
| Molecular formula | C14H10Cl2O2 |
|---|---|
| Molecular weight | 281.1 g/mol |
| IUPAC name | 2-chloro-4-[(E)-2-(3-chloro-4-hydroxyphenyl)ethenyl]phenol |
| InChIKey | FEAJSSRZWFESGG-OWOJBTEDSA-N |
| SMILES | C1=CC(=C(C=C1/C=C/C2=CC(=C(C=C2)O)Cl)Cl)O |
Computed by PubChem (NCBI)