cas: 100382-00-1 — see every product listed under this CAS number, including other names
4-(Benzyloxy)picolinonitrile 98% (CAS 100382-00-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A378338-250mg |
| cas | 100382-00-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 270.25 Pln | |
| Ambeed | 1g | 448.25 Pln | |
| Ambeed | 5g | 1199.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A378338 |
4-phenylmethoxypyridine-2-carbonitrile (CAS 100382-00-1) is a chemical compound with the molecular formula C13H10N2O and a molecular weight of 210.23 g/mol. IUPAC name: 4-phenylmethoxypyridine-2-carbonitrile. InChIKey: KHDORVLVNIOXJY-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 4-phenylmethoxypyridine-2-carbonitrile |
| InChIKey | KHDORVLVNIOXJY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=NC=C2)C#N |
Computed by PubChem (NCBI)