cas: 128293-64-1 — see every product listed under this CAS number, including other names
4-(Boc-amino)-1-methyl-1H-imidazole-2-carboxylic Acid, >98.0%(HPLC)(T) (CAS 128293-64-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B6350-250MG |
| cas | 128293-64-1 |
| size | 250mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 250mg | 591.89 Pln | |
| TCI | 1g | 1408.15 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
1-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]imidazole-2-carboxylic acid (CAS 128293-64-1) is a chemical compound with the molecular formula C10H15N3O4 and a molecular weight of 241.24 g/mol. IUPAC name: 1-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]imidazole-2-carboxylic acid. InChIKey: GZBSJWBQXNCOFP-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O4 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | 1-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]imidazole-2-carboxylic acid |
| InChIKey | GZBSJWBQXNCOFP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CN(C(=N1)C(=O)O)C |
Computed by PubChem (NCBI)