cas: 128293-64-1 — see every product listed under this CAS number, including other names
4-tert-Butoxycarbonylamino-1-methyl-1H-imidazole-2-carboxylic acid, 96% (CAS 128293-64-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F019568-10G |
| cas | 128293-64-1 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 3913.22 Pln | |
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 195.78 Pln | |
| Fluorochem | 1g | 471.73 Pln | |
| Fluorochem | 5g | 1986.82 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
1-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]imidazole-2-carboxylic acid (CAS 128293-64-1) is a chemical compound with the molecular formula C10H15N3O4 and a molecular weight of 241.24 g/mol. IUPAC name: 1-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]imidazole-2-carboxylic acid. InChIKey: GZBSJWBQXNCOFP-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O4 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | 1-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]imidazole-2-carboxylic acid |
| InChIKey | GZBSJWBQXNCOFP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CN(C(=N1)C(=O)O)C |
Computed by PubChem (NCBI)