CAS 549490-15-5 appears in our catalog under these names: N-(4-Bromo-2-fluorophenyl)methanesulfonamide, 98%, N-(4-Bromo-2-fluorophenyl)methanesulfonamide, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 25g, 5g, 1g, 100mg, 250mg.
N-(4-bromo-2-fluorophenyl)methanesulfonamide (CAS 549490-15-5) is a chemical compound with the molecular formula C7H7BrFNO2S and a molecular weight of 268.11 g/mol. IUPAC name: N-(4-bromo-2-fluorophenyl)methanesulfonamide. InChIKey: WKPHSMWPSVEOFI-UHFFFAOYSA-N.
| Molecular formula | C7H7BrFNO2S |
|---|---|
| Molecular weight | 268.11 g/mol |
| IUPAC name | N-(4-bromo-2-fluorophenyl)methanesulfonamide |
| InChIKey | WKPHSMWPSVEOFI-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=C(C=C(C=C1)Br)F |
Computed by PubChem (NCBI)