CAS 874804-15-6 is the registry number for 4-Bromo-2-fluoro-5-methylbenzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
4-bromo-2-fluoro-5-methylbenzenesulfonamide (CAS 874804-15-6) is a chemical compound with the molecular formula C7H7BrFNO2S and a molecular weight of 268.11 g/mol. IUPAC name: 4-bromo-2-fluoro-5-methylbenzenesulfonamide. InChIKey: ATYNVCSFRNYKON-UHFFFAOYSA-N.
| Molecular formula | C7H7BrFNO2S |
|---|---|
| Molecular weight | 268.11 g/mol |
| IUPAC name | 4-bromo-2-fluoro-5-methylbenzenesulfonamide |
| InChIKey | ATYNVCSFRNYKON-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Br)F)S(=O)(=O)N |
Computed by PubChem (NCBI)