Products 1602729-58-7
CAS 1602729-58-7 is the registry number for 4-Bromo-5-fluoro-2-(methylsulphonyl)aniline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-5-fluoro-2-methylsulfonylaniline (CAS 1602729-58-7) is a chemical compound with the molecular formula C7H7BrFNO2S and a molecular weight of 268.11 g/mol. IUPAC name: 4-bromo-5-fluoro-2-methylsulfonylaniline. InChIKey: XRGHVVFAJBPWID-UHFFFAOYSA-N.
| Molecular formula | C7H7BrFNO2S |
|---|---|
| Molecular weight | 268.11 g/mol |
| IUPAC name | 4-bromo-5-fluoro-2-methylsulfonylaniline |
| InChIKey | XRGHVVFAJBPWID-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1N)F)Br |
Computed by PubChem (NCBI)