cas: 7612-88-6 — see every product listed under this CAS number, including other names
4-(Bromomethyl)benzenesulfonyl fluoride, 95-<97% (CAS 7612-88-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 50g, 100g, 200g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC588-95-97-10g |
| cas | 7612-88-6 |
| size | 10g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 10g | 5169.56 Pln | |
| Hoffman Fine Chemicals | 25g | 10024.74 Pln | |
| Hoffman Fine Chemicals | 50g | 15856.06 Pln | |
| Hoffman Fine Chemicals | 100g | 25183.62 Pln | |
| Hoffman Fine Chemicals | 200g | 42594.64 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
4-(bromomethyl)benzenesulfonyl fluoride (CAS 7612-88-6) is a chemical compound with the molecular formula C7H6BrFO2S and a molecular weight of 253.09 g/mol. IUPAC name: 4-(bromomethyl)benzenesulfonyl fluoride. InChIKey: WWAPDVQUZYCNCR-UHFFFAOYSA-N.
| Molecular formula | C7H6BrFO2S |
|---|---|
| Molecular weight | 253.09 g/mol |
| IUPAC name | 4-(bromomethyl)benzenesulfonyl fluoride |
| InChIKey | WWAPDVQUZYCNCR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CBr)S(=O)(=O)F |
Computed by PubChem (NCBI)