cas: 2567-29-5 — see every product listed under this CAS number, including other names
4-(Bromomethyl)biphenyl, 96% (CAS 2567-29-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 368950050 |
| cas | 2567-29-5 |
| size | 5g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 405.35 Pln | |
| Thermo Scientific (Acros) | 25g | 1135.88 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 96% |
1-(bromomethyl)-4-phenylbenzene (CAS 2567-29-5) is a chemical compound with the molecular formula C13H11Br and a molecular weight of 247.13 g/mol. IUPAC name: 1-(bromomethyl)-4-phenylbenzene. InChIKey: HZQLUIZFUXNFHK-UHFFFAOYSA-N.
| Molecular formula | C13H11Br |
|---|---|
| Molecular weight | 247.13 g/mol |
| IUPAC name | 1-(bromomethyl)-4-phenylbenzene |
| InChIKey | HZQLUIZFUXNFHK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)CBr |
Computed by PubChem (NCBI)