cas: 402927-96-2 — see every product listed under this CAS number, including other names
4-(Cbz-amino)-1-(methylsulfonyl)piperidine, ≥95%, ≥95% (CAS 402927-96-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114K7R-1g |
| cas | 402927-96-2 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 952.40 Pln | |
| Chemat | 5g | 2195.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
Benzyl N-(1-methylsulfonylpiperidin-4-yl)carbamate (CAS 402927-96-2) is a chemical compound with the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. IUPAC name: benzyl N-(1-methylsulfonylpiperidin-4-yl)carbamate. InChIKey: PCUZCKVFKVUGIK-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O4S |
|---|---|
| Molecular weight | 312.39 g/mol |
| IUPAC name | benzyl N-(1-methylsulfonylpiperidin-4-yl)carbamate |
| InChIKey | PCUZCKVFKVUGIK-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CCC(CC1)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)